C16H21NO4 — CID 86035362
N-[2-(1,3-benzodioxol-5-yl)ethyl]-N-(3-methylbutyl)-2-oxoacetamide (PubChem CID 86035362) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-N-(3-methylbutyl)-2-oxoacetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-N-(3-methylbutyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 86035362 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-N-(3-methylbutyl)-2-oxoacetamide |
| SMILES | CC(C)CCN(CCc1ccc2c(c1)OCO2)C(=O)C=O |
| InChI | InChI=1S/C16H21NO4/c1-12(2)5-7-17(16(19)10-18)8-6-13-3-4-14-15(9-13)21-11-20-14/h3-4,9-10,12H,5-8,11H2,1-2H3 |
| InChIKey | OACZTGVSPMNJAX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|