C19H21N3O4 — CID 108508568
N-(1,3-benzodioxol-5-ylmethyl)-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108508568) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108508568 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-ethyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | CCN(CCc1ccncc1)C(=O)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H21N3O4/c1-2-22(10-7-14-5-8-20-9-6-14)19(24)18(23)21-12-15-3-4-16-17(11-15)26-13-25-16/h3-6,8-9,11H,2,7,10,12-13H2,1H3,(H,21,23) |
| InChIKey | TWGZAAHSVKFGPX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|