C16H16F7NO3 — CID 622662
N-[1-(1,3-benzodioxol-5-yl)butan-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide (PubChem CID 622662) has the molecular formula C16H16F7NO3 and a molecular weight of 403.29 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)butan-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)butan-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide |
|---|---|
| PubChem CID | 622662 |
| Molecular Formula | C16H16F7NO3 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)butan-2-yl]-2,2,3,3,4,4,4-heptafluoro-N-methylbutanamide |
| SMILES | CCC(Cc1ccc2c(c1)OCO2)N(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H16F7NO3/c1-3-10(6-9-4-5-11-12(7-9)27-8-26-11)24(2)13(25)14(17,18)15(19,20)16(21,22)23/h4-5,7,10H,3,6,8H2,1-2H3 |
| InChIKey | UYLXQHQNBRJTRQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|