C16H25NO3S — CID 175845546
[[(2R)-1-(1,3-benzodioxol-5-yl)butan-2-yl]-methylamino]-tert-butyl-oxidosulfanium (PubChem CID 175845546) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is [[(2R)-1-(1,3-benzodioxol-5-yl)butan-2-yl]-methylamino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(2R)-1-(1,3-benzodioxol-5-yl)butan-2-yl]-methylamino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175845546 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [[(2R)-1-(1,3-benzodioxol-5-yl)butan-2-yl]-methylamino]-tert-butyl-oxidosulfanium |
| SMILES | CC[C@H](Cc1ccc2c(c1)OCO2)N(C)[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C16H25NO3S/c1-6-13(17(5)21(18)16(2,3)4)9-12-7-8-14-15(10-12)20-11-19-14/h7-8,10,13H,6,9,11H2,1-5H3/t13-,21?/m1/s1 |
| InChIKey | JXOOMXGMOITJGB-ILRUXTBWSA-N |
| XLogP | 3.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|