C30H37N7O3 — CID 155420723
tert-butyl N-[[4-amino-7-[(Z)-1-amino-3-iminoprop-1-enyl]-1-(2-phenylmethoxyethyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate (PubChem CID 155420723) has the molecular formula C30H37N7O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is tert-butyl N-[[4-amino-7-[(Z)-1-amino-3-iminoprop-1-enyl]-1-(2-phenylmethoxyethyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[4-amino-7-[(Z)-1-amino-3-iminoprop-1-enyl]-1-(2-phenylmethoxyethyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 155420723 |
| Molecular Formula | C30H37N7O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | tert-butyl N-[[4-amino-7-[(Z)-1-amino-3-iminoprop-1-enyl]-1-(2-phenylmethoxyethyl)imidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate |
| SMILES | [H]/N=C/C=C(\N)c1ccc2c(c1)nc(N)c1nc(CN(CC)C(=O)OC(C)(C)C)n(CCOCc3ccccc3)c12 |
| InChI | InChI=1S/C30H37N7O3/c1-5-36(29(38)40-30(2,3)4)18-25-35-26-27(37(25)15-16-39-19-20-9-7-6-8-10-20)22-12-11-21(23(32)13-14-31)17-24(22)34-28(26)33/h6-14,17,31H,5,15-16,18-19,32H2,1-4H3,(H2,33,34)/b23-13-,31-14+ |
| InChIKey | CXSWDJKCYMZBRO-NMPUEBAJSA-N |
| XLogP | 5.09 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|