C30H36N6O5S — CID 151070236
benzyl N-[[1-[4-[acetyl-(1,1-dioxothietan-3-yl)amino]butyl]-4-aminoimidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate (PubChem CID 151070236) has the molecular formula C30H36N6O5S and a molecular weight of 592.72 g/mol. Its IUPAC name is benzyl N-[[1-[4-[acetyl-(1,1-dioxothietan-3-yl)amino]butyl]-4-aminoimidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate.
| Compound Name | benzyl N-[[1-[4-[acetyl-(1,1-dioxothietan-3-yl)amino]butyl]-4-aminoimidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 151070236 |
| Molecular Formula | C30H36N6O5S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | benzyl N-[[1-[4-[acetyl-(1,1-dioxothietan-3-yl)amino]butyl]-4-aminoimidazo[4,5-c]quinolin-2-yl]methyl]-N-ethylcarbamate |
| SMILES | CCN(Cc1nc2c(N)nc3ccccc3c2n1CCCCN(C(C)=O)C1CS(=O)(=O)C1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H36N6O5S/c1-3-34(30(38)41-18-22-11-5-4-6-12-22)17-26-33-27-28(24-13-7-8-14-25(24)32-29(27)31)36(26)16-10-9-15-35(21(2)37)23-19-42(39,40)20-23/h4-8,11-14,23H,3,9-10,15-20H2,1-2H3,(H2,31,32) |
| InChIKey | MHZDIFKOHPLXKL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 140.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|