C19H29N5 — CID 143201895
2-N-butyl-1-propylimidazo[4,5-c]quinoline-2,4-diamine;ethane (PubChem CID 143201895) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 2-N-butyl-1-propylimidazo[4,5-c]quinoline-2,4-diamine;ethane.
| Compound Name | 2-N-butyl-1-propylimidazo[4,5-c]quinoline-2,4-diamine;ethane |
|---|---|
| PubChem CID | 143201895 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 2-N-butyl-1-propylimidazo[4,5-c]quinoline-2,4-diamine;ethane |
| SMILES | CC.CCCCNc1nc2c(N)nc3ccccc3c2n1CCC |
| InChI | InChI=1S/C17H23N5.C2H6/c1-3-5-10-19-17-21-14-15(22(17)11-4-2)12-8-6-7-9-13(12)20-16(14)18;1-2/h6-9H,3-5,10-11H2,1-2H3,(H2,18,20)(H,19,21);1-2H3 |
| InChIKey | LARGMIAHQVEEMU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|