C23H33N5OS — CID 143030116
2-methyl-1-(2-methylpropyl)-7-[2-(1-methylsulfanylpiperidin-4-yl)ethoxy]imidazo[4,5-c]quinolin-4-amine (PubChem CID 143030116) has the molecular formula C23H33N5OS and a molecular weight of 427.62 g/mol. Its IUPAC name is 2-methyl-1-(2-methylpropyl)-7-[2-(1-methylsulfanylpiperidin-4-yl)ethoxy]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-methyl-1-(2-methylpropyl)-7-[2-(1-methylsulfanylpiperidin-4-yl)ethoxy]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 143030116 |
| Molecular Formula | C23H33N5OS |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-methyl-1-(2-methylpropyl)-7-[2-(1-methylsulfanylpiperidin-4-yl)ethoxy]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CSN1CCC(CCOc2ccc3c(c2)nc(N)c2nc(C)n(CC(C)C)c23)CC1 |
| InChI | InChI=1S/C23H33N5OS/c1-15(2)14-28-16(3)25-21-22(28)19-6-5-18(13-20(19)26-23(21)24)29-12-9-17-7-10-27(30-4)11-8-17/h5-6,13,15,17H,7-12,14H2,1-4H3,(H2,24,26) |
| InChIKey | VVJVWGVMFZMNRN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|