C20H20N4 — CID 11209291
1-(2-methylpropyl)-2-phenylimidazo[4,5-c]quinolin-4-amine (PubChem CID 11209291) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-phenylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-(2-methylpropyl)-2-phenylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 11209291 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-(2-methylpropyl)-2-phenylimidazo[4,5-c]quinolin-4-amine |
| SMILES | CC(C)Cn1c(-c2ccccc2)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C20H20N4/c1-13(2)12-24-18-15-10-6-7-11-16(15)22-19(21)17(18)23-20(24)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3,(H2,21,22) |
| InChIKey | BOIXTBBMBLMMLS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |