C17H21N5 — CID 24852290
15-methyl-13-(2-methylpropyl)-8,11,13,16-tetrazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,11-hexaen-9-amine (PubChem CID 24852290) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 15-methyl-13-(2-methylpropyl)-8,11,13,16-tetrazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,11-hexaen-9-amine.
| Compound Name | 15-methyl-13-(2-methylpropyl)-8,11,13,16-tetrazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,11-hexaen-9-amine |
|---|---|
| PubChem CID | 24852290 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 15-methyl-13-(2-methylpropyl)-8,11,13,16-tetrazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,11-hexaen-9-amine |
| SMILES | CC(C)CN1CC(C)n2c1nc1c(N)nc3ccccc3c12 |
| InChI | InChI=1S/C17H21N5/c1-10(2)8-21-9-11(3)22-15-12-6-4-5-7-13(12)19-16(18)14(15)20-17(21)22/h4-7,10-11H,8-9H2,1-3H3,(H2,18,19) |
| InChIKey | BZMXBFYODKEWSM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |