C17H20N6O — CID 24852178
9-amino-15-methyl-N-propan-2-yl-8,11,13,16-tetrazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,11-hexaene-13-carboxamide (PubChem CID 24852178) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 9-amino-15-methyl-N-propan-2-yl-8,11,13,16-tetrazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,11-hexaene-13-carboxamide.
| Compound Name | 9-amino-15-methyl-N-propan-2-yl-8,11,13,16-tetrazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,11-hexaene-13-carboxamide |
|---|---|
| PubChem CID | 24852178 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 9-amino-15-methyl-N-propan-2-yl-8,11,13,16-tetrazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,11-hexaene-13-carboxamide |
| SMILES | CC(C)NC(=O)N1CC(C)n2c1nc1c(N)nc3ccccc3c12 |
| InChI | InChI=1S/C17H20N6O/c1-9(2)19-17(24)22-8-10(3)23-14-11-6-4-5-7-12(11)20-15(18)13(14)21-16(22)23/h4-7,9-10H,8H2,1-3H3,(H2,18,20)(H,19,24) |
| InChIKey | ULGXLAPNXXNRIP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |