C27H39N5O3 — CID 121363259
N-[4-[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethoxy]butan-2-yl]-1-methylcyclohexane-1-carboxamide (PubChem CID 121363259) has the molecular formula C27H39N5O3 and a molecular weight of 481.64 g/mol. Its IUPAC name is N-[4-[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethoxy]butan-2-yl]-1-methylcyclohexane-1-carboxamide.
| Compound Name | N-[4-[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethoxy]butan-2-yl]-1-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121363259 |
| Molecular Formula | C27H39N5O3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | N-[4-[2-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]ethoxy]butan-2-yl]-1-methylcyclohexane-1-carboxamide |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCOCCC(C)NC(=O)C1(C)CCCCC1 |
| InChI | InChI=1S/C27H39N5O3/c1-19(29-26(33)27(2)13-7-4-8-14-27)11-17-35-18-15-32-22(12-16-34-3)31-23-24(32)20-9-5-6-10-21(20)30-25(23)28/h5-6,9-10,19H,4,7-8,11-18H2,1-3H3,(H2,28,30)(H,29,33) |
| InChIKey | JZJLWAICSYEJIG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|