C22H33N7O2 — CID 142145311
4-amino-N-[2-[2-[4-amino-2-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-1-yl]ethoxy]ethyl]butanamide (PubChem CID 142145311) has the molecular formula C22H33N7O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-amino-N-[2-[2-[4-amino-2-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-1-yl]ethoxy]ethyl]butanamide.
| Compound Name | 4-amino-N-[2-[2-[4-amino-2-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-1-yl]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 142145311 |
| Molecular Formula | C22H33N7O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 4-amino-N-[2-[2-[4-amino-2-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-1-yl]ethoxy]ethyl]butanamide |
| SMILES | CNCCCc1nc2c(N)nc3ccccc3c2n1CCOCCNC(=O)CCCN |
| InChI | InChI=1S/C22H33N7O2/c1-25-11-5-8-18-28-20-21(16-6-2-3-7-17(16)27-22(20)24)29(18)13-15-31-14-12-26-19(30)9-4-10-23/h2-3,6-7,25H,4-5,8-15,23H2,1H3,(H2,24,27)(H,26,30) |
| InChIKey | NQVFLZJPWPEFBM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|