C18H25N4O2P — CID 59796222
2-(dimethylphosphorylmethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 59796222) has the molecular formula C18H25N4O2P and a molecular weight of 360.40 g/mol. Its IUPAC name is 2-(dimethylphosphorylmethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-(dimethylphosphorylmethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 59796222 |
| Molecular Formula | C18H25N4O2P |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-(dimethylphosphorylmethoxymethyl)-1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | CC(C)Cn1c(COCP(C)(C)=O)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C18H25N4O2P/c1-12(2)9-22-15(10-24-11-25(3,4)23)21-16-17(22)13-7-5-6-8-14(13)20-18(16)19/h5-8,12H,9-11H2,1-4H3,(H2,19,20) |
| InChIKey | FMVZVDGFEXSWAF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|