C23H28N6O — CID 143051741
2-[[(E)-ethylideneamino]oxymethyl]-1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine;3-methylpyridine (PubChem CID 143051741) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[[(E)-ethylideneamino]oxymethyl]-1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine;3-methylpyridine.
| Compound Name | 2-[[(E)-ethylideneamino]oxymethyl]-1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine;3-methylpyridine |
|---|---|
| PubChem CID | 143051741 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-[[(E)-ethylideneamino]oxymethyl]-1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine;3-methylpyridine |
| SMILES | C/C=N/OCc1nc2c(N)nc3ccccc3c2n1CC(C)C.Cc1cccnc1 |
| InChI | InChI=1S/C17H21N5O.C6H7N/c1-4-19-23-10-14-21-15-16(22(14)9-11(2)3)12-7-5-6-8-13(12)20-17(15)18;1-6-3-2-4-7-5-6/h4-8,11H,9-10H2,1-3H3,(H2,18,20);2-5H,1H3/b19-4+; |
| InChIKey | XHHNXLRZZOYCCN-RLNUVCJQSA-N |
| XLogP | 4.74 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|