C14H16N4O — CID 118146427
2-(ethoxymethyl)-1-methylimidazo[4,5-c]quinolin-4-amine (PubChem CID 118146427) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1-methylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-(ethoxymethyl)-1-methylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 118146427 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-(ethoxymethyl)-1-methylimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1C |
| InChI | InChI=1S/C14H16N4O/c1-3-19-8-11-17-12-13(18(11)2)9-6-4-5-7-10(9)16-14(12)15/h4-7H,3,8H2,1-2H3,(H2,15,16) |
| InChIKey | BBTRBXPZJTVATE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |