C20H29N5OS — CID 143077937
1-[3-(dimethylaminosulfanyl)-2,2-dimethylpropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 143077937) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is 1-[3-(dimethylaminosulfanyl)-2,2-dimethylpropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[3-(dimethylaminosulfanyl)-2,2-dimethylpropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 143077937 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[3-(dimethylaminosulfanyl)-2,2-dimethylpropyl]-2-(ethoxymethyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)CSN(C)C |
| InChI | InChI=1S/C20H29N5OS/c1-6-26-11-16-23-17-18(14-9-7-8-10-15(14)22-19(17)21)25(16)12-20(2,3)13-27-24(4)5/h7-10H,6,11-13H2,1-5H3,(H2,21,22) |
| InChIKey | LAEZQGUNOXSOKP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|