C13H14N4O — CID 59795786
2-(methoxymethyl)-1-methylimidazo[4,5-c]quinolin-4-amine (PubChem CID 59795786) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(methoxymethyl)-1-methylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-(methoxymethyl)-1-methylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 59795786 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(methoxymethyl)-1-methylimidazo[4,5-c]quinolin-4-amine |
| SMILES | COCc1nc2c(N)nc3ccccc3c2n1C |
| InChI | InChI=1S/C13H14N4O/c1-17-10(7-18-2)16-11-12(17)8-5-3-4-6-9(8)15-13(11)14/h3-6H,7H2,1-2H3,(H2,14,15) |
| InChIKey | VTYSHZYKJOZMSH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |