C17H24N6O — CID 143051873
1-(3-aminopropyl)-2-[(propan-2-ylamino)oxymethyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 143051873) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-(3-aminopropyl)-2-[(propan-2-ylamino)oxymethyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-(3-aminopropyl)-2-[(propan-2-ylamino)oxymethyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 143051873 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-(3-aminopropyl)-2-[(propan-2-ylamino)oxymethyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CC(C)NOCc1nc2c(N)nc3ccccc3c2n1CCCN |
| InChI | InChI=1S/C17H24N6O/c1-11(2)22-24-10-14-21-15-16(23(14)9-5-8-18)12-6-3-4-7-13(12)20-17(15)19/h3-4,6-7,11,22H,5,8-10,18H2,1-2H3,(H2,19,20) |
| InChIKey | CRFMKSLCXWINTB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|