C20H26N4O2 — CID 169015832
[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropyl] formate (PubChem CID 169015832) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is [3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropyl] formate.
| Compound Name | [3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropyl] formate |
|---|---|
| PubChem CID | 169015832 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-2,2-dimethylpropyl] formate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)COC=O |
| InChI | InChI=1S/C20H26N4O2/c1-4-5-10-16-23-17-18(24(16)11-20(2,3)12-26-13-25)14-8-6-7-9-15(14)22-19(17)21/h6-9,13H,4-5,10-12H2,1-3H3,(H2,21,22) |
| InChIKey | GMLPAVAYRIQNAB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|