C21H30N4 — CID 170078321
2-butyl-1-(2,2-dimethylpentyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 170078321) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-butyl-1-(2,2-dimethylpentyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-1-(2,2-dimethylpentyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 170078321 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 2-butyl-1-(2,2-dimethylpentyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)CCC |
| InChI | InChI=1S/C21H30N4/c1-5-7-12-17-24-18-19(25(17)14-21(3,4)13-6-2)15-10-8-9-11-16(15)23-20(18)22/h8-11H,5-7,12-14H2,1-4H3,(H2,22,23) |
| InChIKey | TUABVPQFXMBFDO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |