C26H35N5O2 — CID 137414048
1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-tert-butylpyrrolidine-2,5-dione (PubChem CID 137414048) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-tert-butylpyrrolidine-2,5-dione.
| Compound Name | 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-tert-butylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 137414048 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-tert-butylpyrrolidine-2,5-dione |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCN1C(=O)CC(C(C)(C)C)C1=O |
| InChI | InChI=1S/C26H35N5O2/c1-5-6-13-20-29-22-23(17-11-7-8-12-19(17)28-24(22)27)30(20)14-9-10-15-31-21(32)16-18(25(31)33)26(2,3)4/h7-8,11-12,18H,5-6,9-10,13-16H2,1-4H3,(H2,27,28) |
| InChIKey | SLLHRGATJNPUFG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|