C25H32N6O3S — CID 145439399
N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propanamide (PubChem CID 145439399) has the molecular formula C25H32N6O3S and a molecular weight of 496.64 g/mol. Its IUPAC name is N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propanamide.
| Compound Name | N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 145439399 |
| Molecular Formula | C25H32N6O3S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | N-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propanamide |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)CCN1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C25H32N6O3S/c1-2-3-10-19-29-22-23(16-8-4-5-9-17(16)28-24(22)26)30(19)13-7-6-12-27-20(32)11-14-31-21(33)15-18(35)25(31)34/h4-5,8-9,18,35H,2-3,6-7,10-15H2,1H3,(H2,26,28)(H,27,32) |
| InChIKey | KGXCUVWWIUEYAI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|