C17H23N7O — CID 126651376
2-[2-[2-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]guanidine (PubChem CID 126651376) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[2-[2-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]guanidine.
| Compound Name | 2-[2-[2-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]guanidine |
|---|---|
| PubChem CID | 126651376 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[2-[2-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]guanidine |
| SMILES | CCc1nc2c(N)nc3ccccc3c2n1CCOCCN=C(N)N |
| InChI | InChI=1S/C17H23N7O/c1-2-13-23-14-15(11-5-3-4-6-12(11)22-16(14)18)24(13)8-10-25-9-7-21-17(19)20/h3-6H,2,7-10H2,1H3,(H2,18,22)(H4,19,20,21) |
| InChIKey | GYSOYFKMKRCSHV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|