C24H34N6O2 — CID 155174989
N-[4-[4-amino-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-(2-methyloxolan-3-yl)acetamide (PubChem CID 155174989) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is N-[4-[4-amino-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-(2-methyloxolan-3-yl)acetamide.
| Compound Name | N-[4-[4-amino-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-(2-methyloxolan-3-yl)acetamide |
|---|---|
| PubChem CID | 155174989 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N-[4-[4-amino-2-(ethylaminomethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-N-(2-methyloxolan-3-yl)acetamide |
| SMILES | CCNCc1nc2c(N)nc3ccccc3c2n1CCCCN(C(C)=O)C1CCOC1C |
| InChI | InChI=1S/C24H34N6O2/c1-4-26-15-21-28-22-23(18-9-5-6-10-19(18)27-24(22)25)30(21)13-8-7-12-29(17(3)31)20-11-14-32-16(20)2/h5-6,9-10,16,20,26H,4,7-8,11-15H2,1-3H3,(H2,25,27) |
| InChIKey | WVWUSJUXSWQNBR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|