C34H41BN7O3 — CID 165070201
CID 165070201 (PubChem CID 165070201) has the molecular formula C34H41BN7O3 and a molecular weight of 606.56 g/mol.
| Compound Name | CID 165070201 |
|---|---|
| PubChem CID | 165070201 |
| Molecular Formula | C34H41BN7O3 |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | — |
| SMILES | CCc1nc2c(N)nc3cccnc3c2n1CCCCCC(=O)c1ccccc1N(C)C.CN(C)c1ccccc1C(=O)O.[B] |
| InChI | InChI=1S/C25H30N6O.C9H11NO2.B/c1-4-21-29-23-24(22-18(28-25(23)26)12-10-15-27-22)31(21)16-9-5-6-14-20(32)17-11-7-8-13-19(17)30(2)3;1-10(2)8-6-4-3-5-7(8)9(11)12;/h7-8,10-13,15H,4-6,9,14,16H2,1-3H3,(H2,26,28);3-6H,1-2H3,(H,11,12); |
| InChIKey | GBWJPXJROHGAEV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|