C24H30N6O2S — CID 68799279
3-amino-2-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]benzenesulfonamide (PubChem CID 68799279) has the molecular formula C24H30N6O2S and a molecular weight of 466.61 g/mol. Its IUPAC name is 3-amino-2-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]benzenesulfonamide.
| Compound Name | 3-amino-2-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 68799279 |
| Molecular Formula | C24H30N6O2S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-amino-2-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]benzenesulfonamide |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCc1c(N)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C24H30N6O2S/c1-2-3-14-21-29-22-23(17-10-4-5-12-19(17)28-24(22)26)30(21)15-7-6-9-16-18(25)11-8-13-20(16)33(27,31)32/h4-5,8,10-13H,2-3,6-7,9,14-15,25H2,1H3,(H2,26,28)(H2,27,31,32) |
| InChIKey | SOCAKEFZOJGHRM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|