C24H28FN5O2S — CID 68801702
2-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-4-fluorobenzenesulfonamide (PubChem CID 68801702) has the molecular formula C24H28FN5O2S and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 68801702 |
| Molecular Formula | C24H28FN5O2S |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-4-fluorobenzenesulfonamide |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCc1cc(F)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C24H28FN5O2S/c1-2-3-11-21-29-22-23(18-9-4-5-10-19(18)28-24(22)26)30(21)14-7-6-8-16-15-17(25)12-13-20(16)33(27,31)32/h4-5,9-10,12-13,15H,2-3,6-8,11,14H2,1H3,(H2,26,28)(H2,27,31,32) |
| InChIKey | JIGBRBUSNYGFSZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|