C32H36F4N4O3 — CID 158477509
(2,3,5,6-tetrafluorophenyl) 12-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-7-oxododecanoate (PubChem CID 158477509) has the molecular formula C32H36F4N4O3 and a molecular weight of 600.66 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 12-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-7-oxododecanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 12-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-7-oxododecanoate |
|---|---|
| PubChem CID | 158477509 |
| Molecular Formula | C32H36F4N4O3 |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 12-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)-7-oxododecanoate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCCC(=O)CCCCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C32H36F4N4O3/c1-2-3-16-25-39-29-30(21-14-9-10-15-24(21)38-32(29)37)40(25)18-11-5-7-13-20(41)12-6-4-8-17-26(42)43-31-27(35)22(33)19-23(34)28(31)36/h9-10,14-15,19H,2-8,11-13,16-18H2,1H3,(H2,37,38) |
| InChIKey | JPCXINDZGUZJTB-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|