C34H47N5O — CID 138645094
N-[[4-[[2-butyl-4-(tert-butylamino)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]octanamide (PubChem CID 138645094) has the molecular formula C34H47N5O and a molecular weight of 541.78 g/mol. Its IUPAC name is N-[[4-[[2-butyl-4-(tert-butylamino)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]octanamide.
| Compound Name | N-[[4-[[2-butyl-4-(tert-butylamino)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]octanamide |
|---|---|
| PubChem CID | 138645094 |
| Molecular Formula | C34H47N5O |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.38 |
| IUPAC Name | N-[[4-[[2-butyl-4-(tert-butylamino)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]octanamide |
| SMILES | CCCCCCCC(=O)NCc1ccc(Cn2c(CCCC)nc3c(NC(C)(C)C)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C34H47N5O/c1-6-8-10-11-12-18-30(40)35-23-25-19-21-26(22-20-25)24-39-29(17-9-7-2)37-31-32(39)27-15-13-14-16-28(27)36-33(31)38-34(3,4)5/h13-16,19-22H,6-12,17-18,23-24H2,1-5H3,(H,35,40)(H,36,38) |
| InChIKey | VUYOXYKVPKZVAX-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|