C18H23N5O — CID 23512673
N-[3-(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)propyl]butanamide (PubChem CID 23512673) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[3-(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)propyl]butanamide.
| Compound Name | N-[3-(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 23512673 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[3-(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)propyl]butanamide |
| SMILES | CCCC(=O)NCCCn1c(C)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C18H23N5O/c1-3-7-15(24)20-10-6-11-23-12(2)21-16-17(23)13-8-4-5-9-14(13)22-18(16)19/h4-5,8-9H,3,6-7,10-11H2,1-2H3,(H2,19,22)(H,20,24) |
| InChIKey | GBNHLYAFWGOPDS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|