C34H41N5O2S2 — CID 157112375
N-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-2-[4-(2-oxohex-5-ynylsulfanyl)butylsulfanyl]acetamide (PubChem CID 157112375) has the molecular formula C34H41N5O2S2 and a molecular weight of 615.87 g/mol. Its IUPAC name is N-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-2-[4-(2-oxohex-5-ynylsulfanyl)butylsulfanyl]acetamide.
| Compound Name | N-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-2-[4-(2-oxohex-5-ynylsulfanyl)butylsulfanyl]acetamide |
|---|---|
| PubChem CID | 157112375 |
| Molecular Formula | C34H41N5O2S2 |
| Molecular Weight | 615.87 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | N-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-2-[4-(2-oxohex-5-ynylsulfanyl)butylsulfanyl]acetamide |
| SMILES | C#CCCC(=O)CSCCCCSCC(=O)NCc1ccc(Cn2c(CCCC)nc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C34H41N5O2S2/c1-3-5-11-27(40)23-42-19-9-10-20-43-24-31(41)36-21-25-15-17-26(18-16-25)22-39-30(14-6-4-2)38-32-33(39)28-12-7-8-13-29(28)37-34(32)35/h1,7-8,12-13,15-18H,4-6,9-11,14,19-24H2,2H3,(H2,35,37)(H,36,41) |
| InChIKey | HNHOTLRSWIHGAB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.87 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|