C19H20N6 — CID 126540608
1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine (PubChem CID 126540608) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine.
| Compound Name | 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine |
|---|---|
| PubChem CID | 126540608 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine |
| SMILES | Cc1nc2c(N)nc3ccc(N)cc3c2n1Cc1ccc(CN)cc1 |
| InChI | InChI=1S/C19H20N6/c1-11-23-17-18(15-8-14(21)6-7-16(15)24-19(17)22)25(11)10-13-4-2-12(9-20)3-5-13/h2-8H,9-10,20-21H2,1H3,(H2,22,24) |
| InChIKey | WBXBMMLLLODXNS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|