About 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine
1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine (PubChem CID 126540608) has the molecular formula C19H20N6
and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine.
Molecular Properties
| Compound Name | 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine |
| PubChem CID | 126540608 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine |
| SMILES | Cc1nc2c(N)nc3ccc(N)cc3c2n1Cc1ccc(CN)cc1 |
| InChI | InChI=1S/C19H20N6/c1-11-23-17-18(15-8-14(21)6-7-16(15)24-19(17)22)25(11)10-13-4-2-12(9-20)3-5-13/h2-8H,9-10,20-21H2,1H3,(H2,22,24) |
| InChIKey | WBXBMMLLLODXNS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine?
The IUPAC name of 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine (CID 126540608) is 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine.
What is the SMILES notation for 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine?
The canonical SMILES for 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine is Cc1nc2c(N)nc3ccc(N)cc3c2n1Cc1ccc(CN)cc1.
What is the InChIKey of 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine?
The InChIKey is WBXBMMLLLODXNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6/c1-11-23-17-18(15-8-14(21)6-7-16(15)24-19(17)22)25(11)10-13-4-2-12(9-20)3-5-13/h2-8H,9-10,20-21H2,1H3,(H2,22,24).
What are the key properties of 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine?
1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine has a molecular weight of 332.41 g/mol, XLogP of 2.56, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(aminomethyl)phenyl]methyl]-2-methylimidazo[4,5-c]quinoline-4,8-diamine is sourced from PubChem (CID 126540608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).