C22H25N5O2 — CID 161081613
3-[[4-amino-8-(aminomethyl)-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol (PubChem CID 161081613) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 3-[[4-amino-8-(aminomethyl)-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol.
| Compound Name | 3-[[4-amino-8-(aminomethyl)-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 161081613 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-[[4-amino-8-(aminomethyl)-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
| SMILES | CCCCc1nc2c(N)nc3ccc(CN)cc3c2n1Cc1cccc(O)c1O |
| InChI | InChI=1S/C22H25N5O2/c1-2-3-7-18-26-19-20(27(18)12-14-5-4-6-17(28)21(14)29)15-10-13(11-23)8-9-16(15)25-22(19)24/h4-6,8-10,28-29H,2-3,7,11-12,23H2,1H3,(H2,24,25) |
| InChIKey | LXCPVYWXANUCQQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|