C28H33N5O4 — CID 158768527
3-[[4-amino-2-butyl-8-[3-(3-isocyanatopropoxy)propyl]imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol (PubChem CID 158768527) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3-[[4-amino-2-butyl-8-[3-(3-isocyanatopropoxy)propyl]imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol.
| Compound Name | 3-[[4-amino-2-butyl-8-[3-(3-isocyanatopropoxy)propyl]imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 158768527 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 3-[[4-amino-2-butyl-8-[3-(3-isocyanatopropoxy)propyl]imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
| SMILES | CCCCc1nc2c(N)nc3ccc(CCCOCCCN=C=O)cc3c2n1Cc1cccc(O)c1O |
| InChI | InChI=1S/C28H33N5O4/c1-2-3-10-24-32-25-26(33(24)17-20-8-4-9-23(35)27(20)36)21-16-19(11-12-22(21)31-28(25)29)7-5-14-37-15-6-13-30-18-34/h4,8-9,11-12,16,35-36H,2-3,5-7,10,13-15,17H2,1H3,(H2,29,31) |
| InChIKey | UNOSOWJJZWJJBE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|