C29H31N5O5 — CID 158109982
1-[2-[2-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethyl]pyrrole-2,5-dione (PubChem CID 158109982) has the molecular formula C29H31N5O5 and a molecular weight of 529.60 g/mol. Its IUPAC name is 1-[2-[2-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158109982 |
| Molecular Formula | C29H31N5O5 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 1-[2-[2-[4-amino-2-butyl-1-[(2,5-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-8-yl]ethoxy]ethyl]pyrrole-2,5-dione |
| SMILES | CCCCc1nc2c(N)nc3ccc(CCOCCN4C(=O)C=CC4=O)cc3c2n1Cc1cc(O)ccc1O |
| InChI | InChI=1S/C29H31N5O5/c1-2-3-4-24-32-27-28(34(24)17-19-16-20(35)6-8-23(19)36)21-15-18(5-7-22(21)31-29(27)30)11-13-39-14-12-33-25(37)9-10-26(33)38/h5-10,15-16,35-36H,2-4,11-14,17H2,1H3,(H2,30,31) |
| InChIKey | UMPFWBGGZJXAHB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|