C25H32N5O6P — CID 162065072
[3-[[4-amino-8-[2-(2-aminoethoxy)ethyl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate (PubChem CID 162065072) has the molecular formula C25H32N5O6P and a molecular weight of 529.53 g/mol. Its IUPAC name is [3-[[4-amino-8-[2-(2-aminoethoxy)ethyl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [3-[[4-amino-8-[2-(2-aminoethoxy)ethyl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 162065072 |
| Molecular Formula | C25H32N5O6P |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | [3-[[4-amino-8-[2-(2-aminoethoxy)ethyl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3ccc(CCOCCN)cc3c2n1Cc1cc(OP(=O)(O)O)ccc1O |
| InChI | InChI=1S/C25H32N5O6P/c1-2-3-4-22-29-23-24(30(22)15-17-14-18(6-8-21(17)31)36-37(32,33)34)19-13-16(9-11-35-12-10-26)5-7-20(19)28-25(23)27/h5-8,13-14,31H,2-4,9-12,15,26H2,1H3,(H2,27,28)(H2,32,33,34) |
| InChIKey | UQWZDIPTPJPMRI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 178.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|