C30H36N5O7P — CID 158386686
[2-[[4-amino-2-butyl-8-[3-[3-(prop-2-ynoylamino)propoxy]propyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate (PubChem CID 158386686) has the molecular formula C30H36N5O7P and a molecular weight of 609.62 g/mol. Its IUPAC name is [2-[[4-amino-2-butyl-8-[3-[3-(prop-2-ynoylamino)propoxy]propyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [2-[[4-amino-2-butyl-8-[3-[3-(prop-2-ynoylamino)propoxy]propyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 158386686 |
| Molecular Formula | C30H36N5O7P |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | [2-[[4-amino-2-butyl-8-[3-[3-(prop-2-ynoylamino)propoxy]propyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxyphenyl] dihydrogen phosphate |
| SMILES | C#CC(=O)NCCCOCCCc1ccc2nc(N)c3nc(CCCC)n(Cc4cc(O)ccc4OP(=O)(O)O)c3c2c1 |
| InChI | InChI=1S/C30H36N5O7P/c1-3-5-9-26-34-28-29(35(26)19-21-18-22(36)11-13-25(21)42-43(38,39)40)23-17-20(10-12-24(23)33-30(28)31)8-6-15-41-16-7-14-32-27(37)4-2/h2,10-13,17-18,36H,3,5-9,14-16,19H2,1H3,(H2,31,33)(H,32,37)(H2,38,39,40) |
| InChIKey | QPAQAGRRUMSPAF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|