C29H37ClN5O7P — CID 159856081
[3-[[4-amino-2-butyl-7-[3-[3-[(2-chloroacetyl)amino]propoxy]propyl]imidazo[4,5-c]quinolin-1-yl]methyl]-2-hydroxyphenyl] dihydrogen phosphate (PubChem CID 159856081) has the molecular formula C29H37ClN5O7P and a molecular weight of 634.07 g/mol. Its IUPAC name is [3-[[4-amino-2-butyl-7-[3-[3-[(2-chloroacetyl)amino]propoxy]propyl]imidazo[4,5-c]quinolin-1-yl]methyl]-2-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [3-[[4-amino-2-butyl-7-[3-[3-[(2-chloroacetyl)amino]propoxy]propyl]imidazo[4,5-c]quinolin-1-yl]methyl]-2-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 159856081 |
| Molecular Formula | C29H37ClN5O7P |
| Molecular Weight | 634.07 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | [3-[[4-amino-2-butyl-7-[3-[3-[(2-chloroacetyl)amino]propoxy]propyl]imidazo[4,5-c]quinolin-1-yl]methyl]-2-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3cc(CCCOCCCNC(=O)CCl)ccc3c2n1Cc1cccc(OP(=O)(O)O)c1O |
| InChI | InChI=1S/C29H37ClN5O7P/c1-2-3-10-24-34-26-27(35(24)18-20-8-4-9-23(28(20)37)42-43(38,39)40)21-12-11-19(16-22(21)33-29(26)31)7-5-14-41-15-6-13-32-25(36)17-30/h4,8-9,11-12,16,37H,2-3,5-7,10,13-15,17-18H2,1H3,(H2,31,33)(H,32,36)(H2,38,39,40) |
| InChIKey | IIEKLHAXVIBBCE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.07 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|