C24H28ClN5O9P2 — CID 160835558
[2-[[4-amino-2-butyl-7-[[(2-chloroacetyl)amino]methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-phosphonooxyphenyl] dihydrogen phosphate (PubChem CID 160835558) has the molecular formula C24H28ClN5O9P2 and a molecular weight of 627.92 g/mol. Its IUPAC name is [2-[[4-amino-2-butyl-7-[[(2-chloroacetyl)amino]methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-phosphonooxyphenyl] dihydrogen phosphate.
| Compound Name | [2-[[4-amino-2-butyl-7-[[(2-chloroacetyl)amino]methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-phosphonooxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 160835558 |
| Molecular Formula | C24H28ClN5O9P2 |
| Molecular Weight | 627.92 g/mol |
| Exact Mass | 627.11 |
| IUPAC Name | [2-[[4-amino-2-butyl-7-[[(2-chloroacetyl)amino]methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-4-phosphonooxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3cc(CNC(=O)CCl)ccc3c2n1Cc1cc(OP(=O)(O)O)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C24H28ClN5O9P2/c1-2-3-4-20-29-22-23(17-7-5-14(12-27-21(31)11-25)9-18(17)28-24(22)26)30(20)13-15-10-16(38-40(32,33)34)6-8-19(15)39-41(35,36)37/h5-10H,2-4,11-13H2,1H3,(H2,26,28)(H,27,31)(H2,32,33,34)(H2,35,36,37) |
| InChIKey | YTYCFDAYWBWSPH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 219.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.92 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|