C25H28N5O6P — CID 158211188
[2-[[4-amino-2-butyl-7-[(prop-2-enoylamino)methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate (PubChem CID 158211188) has the molecular formula C25H28N5O6P and a molecular weight of 525.50 g/mol. Its IUPAC name is [2-[[4-amino-2-butyl-7-[(prop-2-enoylamino)methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [2-[[4-amino-2-butyl-7-[(prop-2-enoylamino)methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 158211188 |
| Molecular Formula | C25H28N5O6P |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | [2-[[4-amino-2-butyl-7-[(prop-2-enoylamino)methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
| SMILES | C=CC(=O)NCc1ccc2c(c1)nc(N)c1nc(CCCC)n(Cc3cccc(O)c3OP(=O)(O)O)c12 |
| InChI | InChI=1S/C25H28N5O6P/c1-3-5-9-20-29-22-23(30(20)14-16-7-6-8-19(31)24(16)36-37(33,34)35)17-11-10-15(13-27-21(32)4-2)12-18(17)28-25(22)26/h4,6-8,10-12,31H,2-3,5,9,13-14H2,1H3,(H2,26,28)(H,27,32)(H2,33,34,35) |
| InChIKey | KSBNEOUMTCNODV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 172.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|