C21H23N4O5P — CID 147028427
[3-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-2-hydroxyphenyl] dihydrogen phosphate (PubChem CID 147028427) has the molecular formula C21H23N4O5P and a molecular weight of 442.41 g/mol. Its IUPAC name is [3-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-2-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [3-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-2-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 147028427 |
| Molecular Formula | C21H23N4O5P |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [3-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]-2-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1cccc(OP(=O)(O)O)c1O |
| InChI | InChI=1S/C21H23N4O5P/c1-2-3-11-17-24-18-19(14-8-4-5-9-15(14)23-21(18)22)25(17)12-13-7-6-10-16(20(13)26)30-31(27,28)29/h4-10,26H,2-3,11-12H2,1H3,(H2,22,23)(H2,27,28,29) |
| InChIKey | AXCMWBDFSOQLTO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|