C31H37InN5O6P — CID 153388912
CID 153388912 (PubChem CID 153388912) has the molecular formula C31H37InN5O6P and a molecular weight of 721.46 g/mol.
| Compound Name | CID 153388912 |
|---|---|
| PubChem CID | 153388912 |
| Molecular Formula | C31H37InN5O6P |
| Molecular Weight | 721.46 g/mol |
| Exact Mass | 721.15 |
| IUPAC Name | — |
| SMILES | C#C.C#CC(=O)NC(C)(C)[In].CCCCc1nc2c(N)nc3cc(CC)ccc3c2n1Cc1cccc(OP(=O)(O)O)c1O |
| InChI | InChI=1S/C23H27N4O5P.C6H8NO.C2H2.In/c1-3-5-9-19-26-20-21(16-11-10-14(4-2)12-17(16)25-23(20)24)27(19)13-15-7-6-8-18(22(15)28)32-33(29,30)31;1-4-6(8)7-5(2)3;1-2;/h6-8,10-12,28H,3-5,9,13H2,1-2H3,(H2,24,25)(H2,29,30,31);1H,2-3H3,(H,7,8);1-2H; |
| InChIKey | LTGQDHGJDCQCJU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 172.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|