C24H27ClN5O6P — CID 160982924
[3-[[4-amino-2-butyl-8-[[(2-chloroacetyl)amino]methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-2-hydroxyphenyl] dihydrogen phosphate (PubChem CID 160982924) has the molecular formula C24H27ClN5O6P and a molecular weight of 547.94 g/mol. Its IUPAC name is [3-[[4-amino-2-butyl-8-[[(2-chloroacetyl)amino]methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-2-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [3-[[4-amino-2-butyl-8-[[(2-chloroacetyl)amino]methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-2-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 160982924 |
| Molecular Formula | C24H27ClN5O6P |
| Molecular Weight | 547.94 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | [3-[[4-amino-2-butyl-8-[[(2-chloroacetyl)amino]methyl]imidazo[4,5-c]quinolin-1-yl]methyl]-2-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3ccc(CNC(=O)CCl)cc3c2n1Cc1cccc(OP(=O)(O)O)c1O |
| InChI | InChI=1S/C24H27ClN5O6P/c1-2-3-7-19-29-21-22(30(19)13-15-5-4-6-18(23(15)32)36-37(33,34)35)16-10-14(12-27-20(31)11-25)8-9-17(16)28-24(21)26/h4-6,8-10,32H,2-3,7,11-13H2,1H3,(H2,26,28)(H,27,31)(H2,33,34,35) |
| InChIKey | OGSKATJPOMCHHG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 172.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.94 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|