C26H30N5O6PS — CID 149065054
[2-[[4-amino-2-butyl-7-[2-(2-isothiocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate (PubChem CID 149065054) has the molecular formula C26H30N5O6PS and a molecular weight of 571.60 g/mol. Its IUPAC name is [2-[[4-amino-2-butyl-7-[2-(2-isothiocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [2-[[4-amino-2-butyl-7-[2-(2-isothiocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 149065054 |
| Molecular Formula | C26H30N5O6PS |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | [2-[[4-amino-2-butyl-7-[2-(2-isothiocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3cc(CCOCCN=C=S)ccc3c2n1Cc1cccc(O)c1OP(=O)(O)O |
| InChI | InChI=1S/C26H30N5O6PS/c1-2-3-7-22-30-23-24(31(22)15-18-5-4-6-21(32)25(18)37-38(33,34)35)19-9-8-17(14-20(19)29-26(23)27)10-12-36-13-11-28-16-39/h4-6,8-9,14,32H,2-3,7,10-13,15H2,1H3,(H2,27,29)(H2,33,34,35) |
| InChIKey | QMPBHJCWSDGHLP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 165.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|