C26H29N5O4 — CID 157100241
3-[[4-amino-2-butyl-7-[2-(2-isocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol (PubChem CID 157100241) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-[[4-amino-2-butyl-7-[2-(2-isocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol.
| Compound Name | 3-[[4-amino-2-butyl-7-[2-(2-isocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 157100241 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 3-[[4-amino-2-butyl-7-[2-(2-isocyanatoethoxy)ethyl]imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
| SMILES | CCCCc1nc2c(N)nc3cc(CCOCCN=C=O)ccc3c2n1Cc1cccc(O)c1O |
| InChI | InChI=1S/C26H29N5O4/c1-2-3-7-22-30-23-24(31(22)15-18-5-4-6-21(33)25(18)34)19-9-8-17(14-20(19)29-26(23)27)10-12-35-13-11-28-16-32/h4-6,8-9,14,33-34H,2-3,7,10-13,15H2,1H3,(H2,27,29) |
| InChIKey | TXLAOWWYQNSAHI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|