C26H32N4O2 — CID 153388972
3-[[4-amino-2-butyl-7-(2-methylbutan-2-yl)imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol (PubChem CID 153388972) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-[[4-amino-2-butyl-7-(2-methylbutan-2-yl)imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol.
| Compound Name | 3-[[4-amino-2-butyl-7-(2-methylbutan-2-yl)imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 153388972 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 3-[[4-amino-2-butyl-7-(2-methylbutan-2-yl)imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
| SMILES | CCCCc1nc2c(N)nc3cc(C(C)(C)CC)ccc3c2n1Cc1cccc(O)c1O |
| InChI | InChI=1S/C26H32N4O2/c1-5-7-11-21-29-22-23(30(21)15-16-9-8-10-20(31)24(16)32)18-13-12-17(26(3,4)6-2)14-19(18)28-25(22)27/h8-10,12-14,31-32H,5-7,11,15H2,1-4H3,(H2,27,28) |
| InChIKey | SOIJYUPRAYLVGT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|