C23H23N5O2S — CID 162040396
3-[[4-amino-2-butyl-7-(isothiocyanatomethyl)imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol (PubChem CID 162040396) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 3-[[4-amino-2-butyl-7-(isothiocyanatomethyl)imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol.
| Compound Name | 3-[[4-amino-2-butyl-7-(isothiocyanatomethyl)imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 162040396 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 3-[[4-amino-2-butyl-7-(isothiocyanatomethyl)imidazo[4,5-c]quinolin-1-yl]methyl]benzene-1,2-diol |
| SMILES | CCCCc1nc2c(N)nc3cc(CN=C=S)ccc3c2n1Cc1cccc(O)c1O |
| InChI | InChI=1S/C23H23N5O2S/c1-2-3-7-19-27-20-21(28(19)12-15-5-4-6-18(29)22(15)30)16-9-8-14(11-25-13-31)10-17(16)26-23(20)24/h4-6,8-10,29-30H,2-3,7,11-12H2,1H3,(H2,24,26) |
| InChIKey | PBTZXRQMGBTXGG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|