C35H43N5O5 — CID 153389010
1-[4-[3-[4-amino-2-butyl-1-[(2,3-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]-3-methylbutoxy]-2-methylbutan-2-yl]pyrrole-2,5-dione (PubChem CID 153389010) has the molecular formula C35H43N5O5 and a molecular weight of 613.76 g/mol. Its IUPAC name is 1-[4-[3-[4-amino-2-butyl-1-[(2,3-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]-3-methylbutoxy]-2-methylbutan-2-yl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[3-[4-amino-2-butyl-1-[(2,3-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]-3-methylbutoxy]-2-methylbutan-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 153389010 |
| Molecular Formula | C35H43N5O5 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.33 |
| IUPAC Name | 1-[4-[3-[4-amino-2-butyl-1-[(2,3-dihydroxyphenyl)methyl]imidazo[4,5-c]quinolin-7-yl]-3-methylbutoxy]-2-methylbutan-2-yl]pyrrole-2,5-dione |
| SMILES | CCCCc1nc2c(N)nc3cc(C(C)(C)CCOCCC(C)(C)N4C(=O)C=CC4=O)ccc3c2n1Cc1cccc(O)c1O |
| InChI | InChI=1S/C35H43N5O5/c1-6-7-11-27-38-30-31(39(27)21-22-9-8-10-26(41)32(22)44)24-13-12-23(20-25(24)37-33(30)36)34(2,3)16-18-45-19-17-35(4,5)40-28(42)14-15-29(40)43/h8-10,12-15,20,41,44H,6-7,11,16-19,21H2,1-5H3,(H2,36,37) |
| InChIKey | WGTVEWPYZTXQFM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|