C32H43BrN5O7P — CID 153388857
[2-[[4-amino-8-[4-[2-[(2-bromoacetyl)amino]-2-methylpropoxy]-2-methylbutan-2-yl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate (PubChem CID 153388857) has the molecular formula C32H43BrN5O7P and a molecular weight of 720.60 g/mol. Its IUPAC name is [2-[[4-amino-8-[4-[2-[(2-bromoacetyl)amino]-2-methylpropoxy]-2-methylbutan-2-yl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [2-[[4-amino-8-[4-[2-[(2-bromoacetyl)amino]-2-methylpropoxy]-2-methylbutan-2-yl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 153388857 |
| Molecular Formula | C32H43BrN5O7P |
| Molecular Weight | 720.60 g/mol |
| Exact Mass | 719.21 |
| IUPAC Name | [2-[[4-amino-8-[4-[2-[(2-bromoacetyl)amino]-2-methylpropoxy]-2-methylbutan-2-yl]-2-butylimidazo[4,5-c]quinolin-1-yl]methyl]-6-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CCCCc1nc2c(N)nc3ccc(C(C)(C)CCOCC(C)(C)NC(=O)CBr)cc3c2n1Cc1cccc(O)c1OP(=O)(O)O |
| InChI | InChI=1S/C32H43BrN5O7P/c1-6-7-11-25-36-27-28(38(25)18-20-9-8-10-24(39)29(20)45-46(41,42)43)22-16-21(12-13-23(22)35-30(27)34)31(2,3)14-15-44-19-32(4,5)37-26(40)17-33/h8-10,12-13,16,39H,6-7,11,14-15,17-19H2,1-5H3,(H2,34,35)(H,37,40)(H2,41,42,43) |
| InChIKey | ZHGOPVGQGJORJQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|